S6520149
Benzophenone-d10 , 99atom%D , 22583-75-1
Synonym(s):
Di(phenyl-2,3,4,5,6)-methanone-d10
CAS NO.：22583-75-1
Empirical Formula: C13D10O
Molecular Weight: 192.28
MDL number: MFCD00143675
EINECS: 245-107-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB3154.06 | In Stock |
|
| 5g | RMB7462.51 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-51 °C(lit.) |
| Boiling point: | 305 °C(lit.) |
| Flash point: | 138℃ |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidising agents, strong reducing agents. |
| InChI | 1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | RWCCWEUUXYIKHB-LHNTUAQVSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C(=O)c2c([2H])c([2H])c([2H])c([2H])c2[2H] |
| CAS Number Unlabeled | 119-61-9 |
Description and Uses
Benzophenone-d10, a labeled analogue of Benzophenone (B204980), is used in the manufacturing of antihistamines, hypnotics, insecticides.This compound is a contaminant of emerging concern (CECs)
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| target organs | Liver,Kidney |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Carc. 1B STOT RE 2 Oral |
