PRODUCT Properties
| Melting point: | 31°C |
| Boiling point: | 175.9°C (rough estimate) |
| Density | 0.914 g/mL at 25 °C (lit.) |
| vapor pressure | 71.06Pa at 25℃ |
| refractive index | n |
| Flash point: | 148 °F |
| storage temp. | -70°C |
| form | low melting solid |
| color | Clear, colourless |
| Water Solubility | 1μg/L |
| InChI | InChI=1S/C10H10/c1-3-9-5-7-10(4-2)8-6-9/h3-8H,1-2H2 |
| InChIKey | WEERVPDNCOGWJF-UHFFFAOYSA-N |
| SMILES | C1(C=C)=CC=C(C=C)C=C1 |
| LogP | 4.46 at 25℃ |
| CAS DataBase Reference | 105-06-6 |
| EPA Substance Registry System | p-Divinylbenzene (105-06-6) |
Description and Uses
DVB can be cross-linked with styrene/vinylbenzene chloride and incorporated with multi-walled carbon nanotubes (MWCNTs) to form new microporous nanocomposites for water remediation. It can also be used in combination with polyethylene glycol diacrylate to form linkages with polyethylene oxide (PEO), which can be used as an electrolytic material for lithium batteries.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H351-H361d-H373-H412 |
| Precautionary statements | P273-P280-P301+P312-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 7-23-26-36-45-36/37 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2902900000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |







