S080879
2-Chloro-3′,4′-dimethoxybenzil , 97% , 56159-70-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB429.10 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-123 °C(lit.) |
| Boiling point: | 467.8±45.0 °C(Predicted) |
| Density | 1.267±0.06 g/cm3(Predicted) |
| InChI | 1S/C16H13ClO4/c1-20-13-8-7-10(9-14(13)21-2)15(18)16(19)11-5-3-4-6-12(11)17/h3-9H,1-2H3 |
| InChIKey | ULVSCSFZMZRZHJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1OC)C(=O)C(=O)c2ccccc2Cl |
| EPA Substance Registry System | Ethanedione, (2-chlorophenyl)(3,4-dimethoxyphenyl)- (56159-70-7) |
Description and Uses
2-Chloro-3′,4′-dimethoxybenzil (2-Chloro-3,4-dimethoxybenzil) may be used in the synthesis of 2-(2-chlorophenyl)-3-(3,4-dimethoxyphenyl)quinoxaline and 3-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)-2,5-diphenylcyclopenta-2,4-dienone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






