S112079
≥95%(HPLC) , 82321-04-8
Synonym(s):
N-(2,4-Dinitrophenyl)-6-aminocaproic acid N-succinimidyl ester;N-(2,4-Dinitrophenyl)-6-aminohexanoic acid N-succinimidyl ester
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB1475.77 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152 °C |
| Boiling point: | 591.8±60.0 °C(Predicted) |
| Density | 1.46±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| pka | -4.58±0.50(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| Appearance | Solid Powder |
| InChI | 1S/C16H18N4O8/c21-14-7-8-15(22)18(14)28-16(23)4-2-1-3-9-17-12-6-5-11(19(24)25)10-13(12)20(26)27/h5-6,10,17H,1-4,7-9H2 |
| InChIKey | IYBNUJCDIAGXNX-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(NCCCCCC(=O)ON2C(=O)CCC2=O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 82321-04-8 |
Description and Uses
N-Succinimidyl N-(2,4-dinitrophenyl)-6-aminocaproate is an amine-reactive probe used in the synthesis of DNP labeled biomolecules.
N-(2,4-Dinitrophenyl)-6-aminocaproic acid N-succinimidyl ester is an amine-reactive DNP-X succinimidyl ester that may be used to create bioconjugates that may be detected with anti-dinitrophenyl (anti-DNP) antibodies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
