PRODUCT Properties
| Melting point: | 157-159 °C(lit.) |
| Boiling point: | 280°C (rough estimate) |
| Density | 2.0410 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| pka | -6.83±0.10(Predicted) |
| form | powder |
| InChI | InChI=1S/C6H4ClN3O4/c7-4-1-3(9(11)12)2-5(6(4)8)10(13)14/h1-2H,8H2 |
| InChIKey | LHRIICYSGQGXSX-UHFFFAOYSA-N |
| SMILES | C1(N)=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1Cl |
| CAS DataBase Reference | 3531-19-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloro-4,6-dinitroaniline (3531-19-9) |
Description and Uses
6-Chloro-2,4-dinitroaniline is a useful aromatic building block, and has aquatic toxicity properties.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H411 |
| Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310-P314 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N,T+ |
| Risk Statements | 20/21/22-36/37/38-51/53-33-26/27/28 |
| Safety Statements | 26-28-36/37/39-45-61-36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BX9250000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |






