PRODUCT Properties
Melting point: | 157-159 °C(lit.) |
Boiling point: | 280°C (rough estimate) |
Density | 2.0410 (rough estimate) |
refractive index | 1.6000 (estimate) |
pka | -6.83±0.10(Predicted) |
form | powder |
InChI | InChI=1S/C6H4ClN3O4/c7-4-1-3(9(11)12)2-5(6(4)8)10(13)14/h1-2H,8H2 |
InChIKey | LHRIICYSGQGXSX-UHFFFAOYSA-N |
SMILES | C1(N)=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1Cl |
CAS DataBase Reference | 3531-19-9(CAS DataBase Reference) |
EPA Substance Registry System | 2-Chloro-4,6-dinitroaniline (3531-19-9) |
Description and Uses
6-Chloro-2,4-dinitroaniline is a useful aromatic building block, and has aquatic toxicity properties.
Safety
Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
Signal word | Danger |
Hazard statements | H300+H310+H330-H373-H411 |
Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310-P314 |
Hazard Codes | Xn,N,T+ |
Risk Statements | 20/21/22-36/37/38-51/53-33-26/27/28 |
Safety Statements | 26-28-36/37/39-45-61-36/37 |
RIDADR | UN 2811 6.1/PG 3 |
WGK Germany | 3 |
RTECS | BX9250000 |
TSCA | Yes |
HazardClass | 6.1 |
PackingGroup | III |
HS Code | 29214200 |