PRODUCT Properties
| Melting point: | 108.5-109.5℃ |
| Boiling point: | 517.3±50.0 °C(Predicted) |
| Density | 1.173±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO : 100 mg/mL (258.77 mM) |
| form | Solid |
| color | White to off-white |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C22H26O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-28-22(16(15)12-27-21)14-6-8-18(24-2)20(10-14)26-4/h5-10,15-16,21-22H,11-12H2,1-4H3/t15-,16-,21+,22+/m1/s1 |
| InChIKey | PEUUVVGQIVMSAW-DJDZNOHASA-N |
| SMILES | COc1ccc(cc1OC)[C@@H]2OCC3C2CO[C@H]3c4ccc(OC)c(OC)c4 |
| CAS DataBase Reference | 526-06-7 |
Description and Uses
Cineole can be obtained by extraction from natural plants, such as Umbelliferae, Rutaceae, Aurelianaceae, Magnoliaceae, Daphneaceae.
Eudesmin is used in the bioguided isolation identification and activity evaluation of antifungal compounds from Acorus tatarinowii Schott.
