S2318349
(25R)-cholest-5-en-26-oicacid,3β-hydroxy,powder , 56845-87-5
Synonym(s):
S-1,3,4-Trihydroxy-2-butanone;L -Glycero-2-tetrulose
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB2540.35 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | D18 +11.4° (c = 2.4 in water) |
| Boiling point: | 144.07°C (rough estimate) |
| Density | 1.420 |
| refractive index | 1.4502 (estimate) |
| Flash point: | 110℃ |
| storage temp. | room temp |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Oil |
| pka | 12.00±0.20(Predicted) |
| color | Colourless |
| optical activity | [α]/D 12.0±2.0°, c = 2 in H2O (24 h) |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h3,5-7H,1-2H2/t3-/m0/s1 |
| InChIKey | UQPHVQVXLPRNCX-VKHMYHEASA-N |
| SMILES | C(O)C(=O)[C@@H](O)CO |
Description and Uses
L-(+)-Erythrulose is used as a tanning agent in the cosmetics industry and a source of chiral ethyl ketones used in aldo reaction organic synthesis.
Safety
| WGK Germany | 3 |
| HS Code | 29400090 |
