S2434551
98atom%D , 69441-16-3
Synonym(s):
1,3,5-Trimethylbenzene-d12
| Pack Size | Price | Stock | Quantity |
| 1G | RMB1644.38 | In Stock |
|
| 5G | RMB5376.09 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 0.947 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 112 °F |
| storage temp. | Flammables area |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C9H12/c1-7-4-8(2)6-9(3)5-7/h4-6H,1-3H3/i1D3,2D3,3D3,4D,5D,6D |
| InChIKey | AUHZEENZYGFFBQ-ZPMNDIOMSA-N |
| SMILES | [2H]c1c(c([2H])c(c([2H])c1C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| CAS Number Unlabeled | 108-67-8 |
Description and Uses
1,3,5-Trimethylbenzene-d12 is a labeled analogue of Mesitylene (M258390), which is a precursor to diverse fine chemicals. It is also commonly used as a solvent in the laboratory.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H335-H412 |
| Precautionary statements | P210-P233-P240-P241-P273-P303+P361+P353 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 10-37 |
| Safety Statements | 61 |
| RIDADR | UN 2325 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 28459010 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
