S2562349
Cyprofuram , PESTANAL ,analyticalstandard , 69581-33-5
CAS NO.：69581-33-5
Empirical Formula: C14H14ClNO3
Molecular Weight: 279.72
MDL number: MFCD00078634
EINECS: 274-050-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB342.62 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95℃ |
| Boiling point: | 490.6±40.0 °C(Predicted) |
| Density | 1.437±0.06 g/cm3(Predicted) |
| Flash point: | >100 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -1.00±0.20(Predicted) |
| Major Application | agriculture environmental |
| InChI | 1S/C14H14ClNO3/c15-10-2-1-3-11(8-10)16(13(17)9-4-5-9)12-6-7-19-14(12)18/h1-3,8-9,12H,4-7H2 |
| InChIKey | KRZUZYJEQBXUIN-UHFFFAOYSA-N |
| SMILES | Clc1cccc(c1)N(C2CCOC2=O)C(=O)C3CC3 |
Description and Uses
Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H410 |
| Precautionary statements | P264-P270-P273-P280-P301+P310-P302+P352+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 21-25-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GZ1016000 |
| HS Code | 29321900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 |
