PRODUCT Properties
| Melting point: | 227-231 °C |
| Boiling point: | 563.5±60.0 °C(Predicted) |
| Density | 1.814±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.82±0.10(Predicted) |
| color | Off-White to Light Beige |
| InChI | InChI=1S/C7H5ClN2O6S/c8-6-4(10(13)14)1-3(7(11)12)2-5(6)17(9,15)16/h1-2H,(H,11,12)(H2,9,15,16) |
| InChIKey | ACYLUAGCBGTEJF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=C(Cl)C(S(N)(=O)=O)=C1 |
| CAS DataBase Reference | 22892-96-2(CAS DataBase Reference) |
Description and Uses
Intermediate in the production of Bumetanide
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2935909097 |
