PRODUCT Properties
| Melting point: | 56-58 °C(lit.) |
| Boiling point: | 366.92°C (rough estimate) |
| Density | 1.0083 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | −20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Yellow to Orange |
| Stability: | Light Sensitive, Temperature Sensitive |
| InChI | 1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8-,17-13+ |
| InChIKey | NCYCYZXNIZJOKI-MKOSUFFBSA-N |
| SMILES | CC(=C\C=O)/C=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| EPA Substance Registry System | Retinal, 9-cis- (514-85-2) |
Description and Uses
9-cis-Retinal is an isomer of all-trans-Retinal (R240000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-38 |
| Safety Statements | 22-36/37 |
| WGK Germany | 3 |
| RTECS | VH6406500 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Skin Irrit. 2 |
