S3219051
Phyllanthin , phyproof ReferenceSubstance , 10351-88-9
Synonym(s):
(2S,3S)-(+)-1,4-Dimethoxy-2,3-diveratrylbutane
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB5998.22 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96℃ |
| Boiling point: | 530.6±50.0 °C(Predicted) |
| Density | 1.069 |
| storage temp. | 15-25°C |
| solubility | DMF: 15 mg/ml; DMSO: 10 mg/ml; Ethanol: 5 mg/ml |
| form | Solid |
| color | White to off-white |
| BRN | 2066503 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C24H34O6/c1-25-15-19(11-17-7-9-21(27-3)23(13-17)29-5)20(16-26-2)12-18-8-10-22(28-4)24(14-18)30-6/h7-10,13-14,19-20H,11-12,15-16H2,1-6H3/t19-,20-/m1/s1 |
| InChIKey | KFLQGJQSLUYUBF-WOJBJXKFSA-N |
| SMILES | COC[C@@H](Cc1ccc(OC)c(OC)c1)[C@@H](COC)Cc2ccc(OC)c(OC)c2 |
| LogP | 4.110 (est) |
Description and Uses
Phyllanthin is a chemical extract from the Phyllanthus niruri plant and displays pharmacological effects as an anti-diabetic action, anti-arthritic, and inhibitor of P-gp.
Safety
| WGK Germany | 3 |
| HS Code | 3824999270 |
| Storage Class | 11 - Combustible Solids |
