PRODUCT Properties
| Melting point: | 177-178°C |
| Boiling point: | 446.6±45.0 °C(Predicted) |
| Density | 1.353±0.06 g/cm3(Predicted) |
| pka | 8.67±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | 1S/C16H12O4/c1-19-11-7-8-12-13(9-11)20-16(15(18)14(12)17)10-5-3-2-4-6-10/h2-9,18H,1H3 |
| InChIKey | IPRIGHIBTRMTDP-UHFFFAOYSA-N |
| SMILES | COc1ccc2C(=O)C(O)=C(Oc2c1)c3ccccc3 |
| LogP | 3.670 (est) |
Description and Uses
7-Methoxyflavonol (cas# 7478-60-6) is a flavenoid which, as a class of compounds, have broad pharmacological activity, including binding to biomolecules such as enzymes, hormone carriers, and DNA, chelating transition metal ions, catalyzing electron transport, and scavenging free radicals.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
