S381580
≥99%(capillaryGC) , 544-64-9
Synonym(s):
cis-9-Tetradecenoic acid
CAS NO.:544-64-9
Empirical Formula: C14H26O2
Molecular Weight: 226.35
MDL number: MFCD00004436
EINECS: 208-876-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1472.26 | In Stock |
|
| 1g | RMB5991.77 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −4.5-−4 °C(lit.) |
| Boiling point: | 144 °C0.6 mm Hg(lit.) |
| Density | 0.9 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 62 °C |
| storage temp. | -20°C |
| solubility | Benzene (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 4.78±0.10(Predicted) |
| color | Colourless |
| biological source | plant |
| Cosmetics Ingredients Functions | NOT REPORTED |
| InChI | InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/b6-5- |
| InChIKey | YWWVWXASSLXJHU-WAYWQWQTSA-N |
| SMILES | C(O)(=O)CCCCCCC/C=C\CCCC |
| LogP | 5.383 (est) |
| EPA Substance Registry System | 9-Tetradecenoic acid, (9Z)- (544-64-9) |
Description and Uses
Myristoleic Acid induces apoptosis and necrosis in human prostrate cancer cell LNCaP, and is of a potential for developing an attractive new tool for the treatment of prostrate cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





