S3817451
phyproof ReferenceSubstance , 465-39-4
Synonym(s):
14,15-β-epoxy-3-β-hydroxy-5-β-bufa-20,22-dienolide;Bufogenin;RBG;Recibufogenin;Respigon
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB4215.54 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-140°/155-168° |
| alpha | D22 -7.1° (c = 1.259 in chloroform); D16 -5.4° (c = 2.030 in chloroform) |
| Boiling point: | 431.17°C (rough estimate) |
| Density | 1.0474 (rough estimate) |
| refractive index | 1.4860 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMF: 25 mg/mL; DMF:PBS(pH 7.2)(1:1): 0.5 mg/mL; DMSO: 20 mg/mL; Ethanol: 5 mg/mL |
| form | White to off-white solid. |
| pka | 15.14±0.70(Predicted) |
| color | White to off-white |
| Stability: | Moisture Sensitive |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | ATLJNLYIJOCWJE-CWMZOUAVSA-N |
| SMILES | C[C@@]12[C@@]3(O[C@@H]3C[C@@H]2C4=COC(C=C4)=O)[C@]5([H])CC[C@]6([H])C[C@@H](O)CC[C@]6(C)[C@@]5([H])CC1 |
Description and Uses
As one of the active components of Bufonis bufa, Resibufogenin is speculated that Etobufaxin can inhibit the proliferation of tumor cells by inducing apoptosis of osteosarcoma cells.
Resibufogenin is used for content determination/identification/pharmacological experiments, etc.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P280-P301+P310+P330-P302+P352+P310-P304+P340+P310 |
| Safety Statements | 24/25 |
| RIDADR | 3172 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29322090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral |
| Toxicity | LD50 oral in mouse: 59800mg/kg |
