S454378
7-(Carboxymethoxy)-4-methylcoumarin , 97% , 64700-15-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1528.67 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206-208 °C (lit.) |
| Boiling point: | 458.5±45.0 °C(Predicted) |
| Density | 1.375±0.06 g/cm3(Predicted) |
| pka | 3.05±0.10(Predicted) |
| InChI | 1S/C12H10O5/c1-7-4-12(15)17-10-5-8(2-3-9(7)10)16-6-11(13)14/h2-5H,6H2,1H3,(H,13,14) |
| InChIKey | SGCOMUOACCXIKH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)Oc2cc(OCC(O)=O)ccc12 |
| CAS DataBase Reference | 64700-15-8(CAS DataBase Reference) |
Description and Uses
7-(Carboxymethoxy)-4-methylcoumarin (CMC) was used in the preparation of poly(4-vinyl pyridine)-CMC, photosensitive polymer and 3-chloro-7-[(chlorocarbonyl)methoxy]-4-methylcoumarin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
