PRODUCT Properties
| Melting point: | 33.52°C |
| Boiling point: | 120-121 °C/756 mmHg (lit.) |
| Density | 0.835 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 92 °F |
| pka | 14.81±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless |
| Stability: | Flammable. Incompatible with strong oxidizing agents, strong acids, acid chlorides, acid anhydrides. |
| InChI | InChI=1S/C5H10O/c1-3-5(2)4-6/h3,5-6H,1,4H2,2H3 |
| InChIKey | NVGOATMUHKIQQG-UHFFFAOYSA-N |
| SMILES | C(O)C(C)C=C |
| LogP | 1.033 (est) |
| EPA Substance Registry System | 3-Buten-1-ol, 2-methyl- (4516-90-9) |
Description and Uses
2-Methyl-3-buten-1-ol is a useful research chemical used as a reactant in the preparation of macrolides by ring closing metathesis.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 16-29-33 |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |







