A3421112
Dihydrocytochalasin B , ≥98%(HPLC) , 39156-67-7
Synonym(s):
Cytochalasin B, Dihydro- - CAS 39156-67-7 - Calbiochem
CAS NO.：39156-67-7
Empirical Formula: C29H39NO5
Molecular Weight: 481.62
MDL number: MFCD12910542
EINECS: 254-324-4
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB1699.20 | In Stock |
|
| 5MG | RMB5432.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-205 °C |
| Boiling point: | 727.5±60.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:20): 0.05 mg/ml; DMSO: 20 mg/ml; Ethanol: 20 mg/ml |
| form | White solid |
| pka | 13.65±0.70(Predicted) |
| color | white |
| InChIKey | WIULKAASLBZREV-PEVBMUQXNA-N |
| SMILES | [C@H]1(C(=C)[C@H]([C@]2([C@]3(OC(CC[C@H](O)CCC[C@@H](C)CC=C2)=O)C(=O)N[C@@H](CC2C=CC=CC=2)[C@]13[H])[H])O)C |t:18,&1:0,3,4,5,10,15,24,32,r| |
Description and Uses
Dihydrocytochalasin B is a cell morphology and motility and inducer.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H351 |
| Precautionary statements | P201-P202-P260-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+,T |
| Risk Statements | 26/27/28-40 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | RO0205000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29349990 |
