S8940814
36011-19-5
CAS NO.:36011-19-5
Empirical Formula: C28H33NO7
Molecular Weight: 495.56
MDL number: MFCD00005178
EINECS: 252-835-7
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB2706.00 | In Stock |
|
| 5mg | RMB10689.10 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206 °C |
| Boiling point: | 587.59°C (rough estimate) |
| Density | 1.2415 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| storage temp. | -20°C |
| solubility | DMF: 11 mg/ml; DMF:PBS (pH7.2) (1:30): 0.03 mg/ml; DMSO: 10 mg/ml; Ethanol: 2 mg/ml |
| form | White solid. |
| pka | 11.22±0.70(Predicted) |
| color | White to off-white |
| BRN | 1096975 |
| InChIKey | LAJXCUNOQSHRJO-ZYGJITOWSA-N |
| SMILES | C[C@H]1C\C=C\[C@H]2[C@@H]3O[C@]3(C)[C@@H](C)[C@H]4[C@H](Cc5ccccc5)NC(=O)[C@@]24OC(=O)O\C=C\[C@@](C)(O)C1=O |
| LogP | 1.920 (est) |
Description and Uses
The cytochalasins are cell-
Cytochalasin E has been used as:
- a toxin to study its effects on avocado plants
- a component of the incubating medium in feline junctional adhesion molecule 1 (fJAM-1) expression assay
- an inhibitor of actin polymerization to study its effects on mitochondria uptake by mice endothelial cells
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H310-H330-H361 |
| Precautionary statements | P260-P264-P280-P284-P301+P310-P302+P350 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,T |
| Risk Statements | 26/27/28-63 |
| Safety Statements | 28-36/37-45 |
| RIDADR | UN 1544 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | HA5360000 |
| F | 10 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29349990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral Repr. 2 |
| Hazardous Substances Data | 36011-19-5(Hazardous Substances Data) |








