S522278
(S)-(?)-Pulegone , 98% , 3391-90-0
Synonym(s):
(−)-Pulegone;(S)-p-Menth-4(8)-en-3-one;(S)-2-Isopropylidene-5-methylcyclohexanone
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB1307.86 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 244°C |
| Boiling point: | 223-224 °C |
| Density | 0.937 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethanol (Slightly) |
| form | Oil |
| color | Colourless |
| Odor | minty |
| optical activity | [α]20/D 22°, neat |
| BRN | 2040703 |
| Dielectric constant | 9.5（20℃） |
| InChI | 1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | NZGWDASTMWDZIW-QMMMGPOBSA-N |
| SMILES | C[C@H]1CC\C(=C(/C)C)C(=O)C1 |
| LogP | 2.556 (est) |
Description and Uses
(S)-Pulegone is the stereoisomer of (R)-Pulegone (P840140) which is a monoterpene, commonly found in the essential oils of Nepeta cataria (Catnip).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 11 - Combustible Solids |
