S530680
6009-98-9
Synonym(s):
2-([3α,7α-Dihydroxy-24-oxo-5β-cholan-24-yl]amino)ethanesulfonic acid sodium salt;3α,7α-Dihydroxy-5β-cholan-24-oic acid N-(2-sulfoethyl)amide sodium salt;Taurochenodeoxycholic acid sodium salt
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1452.41 | In Stock |
|
| 250mg | RMB4478.75 | In Stock |
|
| 1g | RMB7649.23 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-175 °C |
| storage temp. | room temp |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | <2 |
| color | White to Off-White |
| BRN | 3901205 |
| Stability: | Hygroscopic |
| InChIKey | IYPNVUSIMGAJFC-UKYQSIPTNA-M |
| SMILES | [Na].[S](=O)(=O)(O)CCNC(=O)CC[C@H]([C@@H]1[C@@]2([C@H]([C@H]3[C@@H]([C@@]4([C@H](C[C@H]3O)C[C@@H](CC4)O)C)CC2)CC1)C)C |
| CAS DataBase Reference | 6009-98-9(CAS DataBase Reference) |
Description and Uses
Taurochenodeoxycholic acid (TCDCA) is a taurine-conjugated form of the primary bile acid chenodeoxycholic acid (CDCA; ). Serum levels of TCDCA increase approximately 5-fold in within two hours and begin to decrease within four hours during an oral lipid tolerance test in humans. Serum levels of TCDCA are increased in patients with liver cirrhosis and may serve as a marker of disease progression.
Labeled Taurochenodeoxycholic Acid, intended for use as an internal standard for the quantification of Taurochenodeoxycholic Acid by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |



![(4R)-methyl 4-((3R,5S,8R,9S,10S,12S,13R,14S)-3,12-dihydroxy-10,13-dimethyl-7-oxohexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate](https://img.chemicalbook.com/CAS/20180629/GIF/15073-97-9.gif)


