S5867149
Ethyl-d5-aminehydrochloride , 99atom%D , 284474-81-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24191.03 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-108 °C (lit.) |
| Flash point: | -37℃ |
| storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C2H7N.ClH/c1-2-3;/h2-3H2,1H3;1H |
| InChIKey | XWBDWHCCBGMXKG-LUIAAVAXSA-N |
| SMILES | C([H])([H])(N)C([H])([H])[H].Cl |
| CAS Number Unlabeled | 557-66-4 |
Description and Uses
The labelled version of Ethylamine Hydrochloride, a chemical used in various chemical organic syntheses and biological studies.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
