S6052049
Bromoaceticacid-d3 , 98atom%D , 14341-48-1
Synonym(s):
Bromotrideuterioacetic acid
| Pack Size | Price | Stock | Quantity |
| 5g | RMB6664.29 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-49 °C (lit.) |
| Boiling point: | 208 °C (lit.) |
| Flash point: | >230 °F |
| storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Low-Melting Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | 1S/C2H3BrO2/c3-1-2(4)5/h1H2,(H,4,5)/i1D2/hD |
| InChIKey | KDPAWGWELVVRCH-RIAYTAFFSA-N |
| SMILES | [2H]OC(=O)C([2H])([2H])Br |
Description and Uses
Bromoacetic Acid-d3 can be used as crth2 antagonists to treat allergic diseases, eosinophil-?related diseases and basophil-?related diseases
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H314-H317-H410 |
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T,C,N |
| Risk Statements | 23/24/25-35-50-43 |
| Safety Statements | 26-36/37/39-45-61 |
| RIDADR | UN 3425 8/PG 2 |
| WGK Germany | 2 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Aquatic Acute 1 Eye Dam. 1 Skin Corr. 1A Skin Sens. 1 |
