S6103449
1-Propanol-d8 , 98atom%D , 61393-63-3
Synonym(s):
Deuterated Propanol;Deuterated propyl alcohol;Propyl alcohol-d8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB7499.58 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −127 °C(lit.) |
| Boiling point: | 97 °C(lit.) |
| Density | 0.912 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 59 °F |
| InChI | 1S/C3H8O/c1-2-3-4/h4H,2-3H2,1H3/i1D3,2D2,3D2,4D |
| InChIKey | BDERNNFJNOPAEC-RIZALVEQSA-N |
| SMILES | [2H]OC([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| CAS Number Unlabeled | 71-23-8 |
Description and Uses
1-Propanol-d8 is an intermediate used in the preparation of perdeuterated carboxylates, alcohols and alkyl bromides.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H318-H336 |
| Precautionary statements | P210-P233-P240-P241-P280-P305+P351+P338 |
| target organs | Central nervous system |
| Hazard Codes | F,Xi |
| Risk Statements | 11-41-67 |
| Safety Statements | 7-16-24-26-39 |
| RIDADR | UN 1274 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 STOT SE 3 |
