M1517941
1-Propan-1,1,2,2,3,3,3-d7-ol , BR , 102910-31-6
Synonym(s):
1-Propan-d7-ol;Propyl-d7 alcohol
CAS NO.：102910-31-6
Empirical Formula: C3HD7O
Molecular Weight: 67.14
MDL number: MFCD00190502
EINECS: 200-746-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB5760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -127 °C(lit.) |
| Boiling point: | 97 °C(lit.) |
| Density | 0.896 g/mL at 25 °C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | 1S/C3H8O/c1-2-3-4/h4H,2-3H2,1H3/i1D3,2D2,3D2 |
| InChIKey | BDERNNFJNOPAEC-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
| CAS Number Unlabeled | 71-23-8 |
Description and Uses
1-Propan-1,1,2,2,3,3,3-d7-ol is the isotope labelled analogue of 1-Propanol, an industrial solvent used mainly for resins and cellulose esters.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H336-H225-H318 |
| Precautionary statements | P261-P271-P304+P340-P312-P403+P233-P405-P501-P280-P305+P351+P338-P310-P210-P233-P240-P241-P242-P243-P280-P303+P361+P353-P370+P378-P403+P235-P501 |
| target organs | Central nervous system |
| Hazard Codes | F,Xi |
| Risk Statements | 11-41-67 |
| Safety Statements | 7-16-24-26-39 |
| WGK Germany | WGK 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 STOT SE 3 |
