S6183649
(2R)-(?)-Glycidyl4-nitrobenzoate , 98% , 106268-95-5
Synonym(s):
(R)-(−)-Glycidyl 4-nitrobenzoate;(R)-(−)-Oxirane-2-methanol 4-nitrobenzoate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB496.76 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-62 °C (lit.) |
| storage temp. | 2-8°C |
| form | solid |
| optical activity | [α]19/D 37°, c = 1.08 in chloroform |
| BRN | 5278590 |
| InChI | 1S/C10H9NO5/c12-10(16-6-9-5-15-9)7-1-3-8(4-2-7)11(13)14/h1-4,9H,5-6H2/t9-/m1/s1 |
| InChIKey | MUWIANZPEBMVHH-SECBINFHSA-N |
| SMILES | [O-][N+](=O)c1ccc(cc1)C(=O)OC[C@H]2CO2 |
Description and Uses
(2R)-(?)-Glycidyl 4-nitrobenzoate can be used as a starting material in the total synthesis of leukotriene B4.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | RR0511000 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
