S6184249
2-(4-Bromophenyl)-6-(4-chlorophenyl)pyridine-4-carboxylicacid , 97% , 38935-52-3
CAS NO.：38935-52-3
Empirical Formula: C18H11BrClNO2
Molecular Weight: 388.64
MDL number: MFCD03094027
| Pack Size | Price | Stock | Quantity |
| 1g | RMB485.56 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 291-294 °C (lit.) |
| InChI | 1S/C18H11BrClNO2/c19-14-5-1-11(2-6-14)16-9-13(18(22)23)10-17(21-16)12-3-7-15(20)8-4-12/h1-10H,(H,22,23) |
| InChIKey | APLDOGUHCNVFLZ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(nc(c1)-c2ccc(Br)cc2)-c3ccc(Cl)cc3 |
Description and Uses
2-(4-Bromophenyl)-6-(4-chlorophenyl)pyridine-4-carboxylic acid [BPCPPCA] bears three functional groups: bromophenyl, chlorophenyl and carboxylic acid group. These groups facilitate the deposition of BPCPPCA molecules on the surface of a bulk insulator (calcite) at room temperature leading to hierarchical polymerization.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
