S6547149
2,6-Diphenylisonicotinicacid , 97% , 38947-57-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB346.70 | In Stock |
|
| 5g | RMB1697.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 283-286 °C(lit.) |
| Boiling point: | 548.6±50.0 °C(Predicted) |
| Density | 1.219±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 1.83±0.10(Predicted) |
| Appearance | Light brown to brown Solid |
| InChI | 1S/C18H13NO2/c20-18(21)15-11-16(13-7-3-1-4-8-13)19-17(12-15)14-9-5-2-6-10-14/h1-12H,(H,20,21) |
| InChIKey | PWKUURSWFJBXGO-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(nc(c1)-c2ccccc2)-c3ccccc3 |
Description and Uses
2,6-Diphenylisonicotinic acid may be used as one of the reactants in the synthesis of 7-substituted spiro[chroman-2,4′-piperidin]-4-one derivatives and ethyl 2,6-diphenylisonicotinate (a tridentate ligand).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
