S6208951
PESTANAL ,analyticalstandard , 163165-75-1
Synonym(s):
2-Chloro-4-pentadeuteroethylamino-6-isopropylamino-1,3,5-triazine
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB3239.35 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-174°C |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | White to off-white |
| Major Application | agriculture environmental |
| InChI | 1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14)/i1D3,4D2 |
| InChIKey | MXWJVTOOROXGIU-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])Nc1nc(Cl)nc(NC(C)C)n1 |
| EPA Substance Registry System | 1,3,5-Triazine-2,4-diamine, 6-chloro-N-(ethyl-d5)-N'-(1-methylethyl)- (163165-75-1) |
Description and Uses
Labelled selective herbicide. Potential symptoms of overexposure are irritation of eyes and skin; dermatitis, skin sensitization; dyspnea, weakness, incoordination, salivation; hypothermia; liver injury
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H373-H410 |
| Precautionary statements | P260-P272-P273-P280-P302+P352-P314 |
| target organs | Heart |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,N |
| Risk Statements | 43-48/22-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT RE 2 Oral |
