S6248749
L-Tyrosinehydrochloride , ≥98%(TLC) , 16870-43-2
Synonym(s):
3-(4-Hydroxyphenyl)-L -alanine;3-(4-Hydroxyphenyl)-L -alanine hydrochloride
CAS NO.:16870-43-2
Empirical Formula: C9H12ClNO3
Molecular Weight: 217.65
MDL number: MFCD00012617
EINECS: 628-139-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB842.87 | In Stock |
|
| 5g | RMB2425.12 | In Stock |
|
| 10g | RMB4155.24 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| form | powder |
| color | white to off-white |
| biological source | synthetic (organic) |
| optical activity | -9.0° (C=1.0 g/100ml, HCL) |
| InChI | 1S/C9H11NO3.ClH/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;/h1-4,8,11H,5,10H2,(H,12,13);1H/t8-;/m0./s1 |
| InChIKey | JJWFIVDAMOFNPS-QRPNPIFTSA-N |
| SMILES | Cl[H].N[C@@H](Cc1ccc(O)cc1)C(O)=O |
| CAS DataBase Reference | 16870-43-2(CAS DataBase Reference) |
Description and Uses
L-Tyrosine Hydrochloride is the salt form of L-Tyrosine (T899975), is one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters such as dopamine, norepinephrine, and epinephrine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1789 8/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





