S6297249
(4S,5R)-(?)-cis-4,5-Diphenyl-2-oxazolidinone , 98% , 23204-70-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1195.98 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 227-232 °C(lit.) |
| Boiling point: | 466.6±45.0 °C(Predicted) |
| Density | 1.192±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly) |
| pka | 11.56±0.60(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]23/D 57±4°, c = 2 in chloroform (or methanol) |
| InChI | 1S/C15H13NO2/c17-15-16-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10,13-14H,(H,16,17)/t13-,14+/m0/s1 |
| InChIKey | LTENIVFVXMCOQI-UONOGXRCSA-N |
| SMILES | O=C1N[C@H]([C@H](O1)c2ccccc2)c3ccccc3 |
Description and Uses
(4S,5R)-(-)-cis-Diphenyl-2-oxazolidinone is used as a catalyst in the enantioselective synthesis of chiral phthalides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
