S6496449
clone4D6,purifiedimmunoglobulin,bufferedaqueoussolution
| Pack Size | Price | Stock | Quantity |
| 100μG | RMB3465.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-111 °C (lit.) |
| Boiling point: | 312.2±41.0 °C(Predicted) |
| Density | 0.891±0.06 g/cm3(Predicted) |
| pka | 3.82±0.12(Predicted) |
| form | powder |
| InChI | 1S/C19H33N/c1-17(2,3)13-11-14(18(4,5)6)16(20-10)15(12-13)19(7,8)9/h11-12,20H,1-10H3 |
| InChIKey | GFTNLYGZUUPSSM-UHFFFAOYSA-N |
| SMILES | CNc1c(cc(cc1C(C)(C)C)C(C)(C)C)C(C)(C)C |
Description and Uses
2,4,6-Tri-tert-butyl-N-methylaniline may be used in the synthesis of 2,5-di-tert-butyl-N,N-dimethylanilinium iodide and 2,5-di-tert-butyl-N-ethyl-N-ethylanilinium iodide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




