S7290827
Acetic acid-1-13C,d4 , 98atom%D,99atom%13C , 63459-47-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB8211.03 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 16.2 °C (lit.) |
| Boiling point: | 117-118 °C (lit.) |
| Density | 1.136 g/mL at 25 °C |
| vapor density | 2.07 (vs air) |
| vapor pressure | 11.4 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 104 °F |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Colourless |
| explosive limit | 16% |
| Stability: | Volatile |
| InChI | 1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3,2+1/hD |
| InChIKey | QTBSBXVTEAMEQO-OIFRIMMXSA-N |
| SMILES | [2H]O[13C](=O)C([2H])([2H])[2H] |
| CAS Number Unlabeled | 64-19-7 |
Description and Uses
ACETIC-1-13C-2-D3 ACID-1 H (D) is used in the technique for determining the concentration and 13C enrichment of acetate in biological fluids.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 10-35 |
| Safety Statements | 16-26-36/37/39-45-23 |
| RIDADR | UN 2789 8/PG 2 |
| WGK Germany | 3 |
| Autoignition Temperature | 800 °F |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1A |







