PRODUCT Properties
| Melting point: | 350-351 °C (lit.) |
| Boiling point: | 552.9±45.0 °C(Predicted) |
| Density | 1.527±0.06 g/cm3(Predicted) |
| pka | 7.84±0.20(Predicted) |
| form | solid |
| InChI | 1S/C18H10O4/c19-15-9-5-1-2-6-10(9)16(20)14-13(15)17(21)11-7-3-4-8-12(11)18(14)22/h1-8,19-20H |
| InChIKey | QECAURYYBPUIFF-UHFFFAOYSA-N |
| SMILES | Oc1c2C(=O)c3ccccc3C(=O)c2c(O)c4ccccc14 |
Description and Uses
6,11-Dihydroxy-5,12-naphthacenedione was used in the synthesis of a tetracene derivative, 5,6,11,12-tetrachlorotetracene. It was also used for the synthesis of (3Z,3′Z)-3,3′-(ethane-1,2-diylidene)bis[isobenzofuran-1(3H)-one]. It may be used for the following studies:
- Synthesis of self-assembled, chair-shaped dirhenium(I) macrocyclic compounds.
- Synthesis of half-sandwich Ir, Rh-based organometallic molecular boxes.
- As ligand for the synthesis of supramolecular coordination complexes (SCCs).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
