S747078
PAMAM dendrimer , ethylenediaminecore,generation0.0solution,20?wt.%inmethanol , 155773-72-1
CAS NO.:155773-72-1
Empirical Formula: C22H48N10O4
Molecular Weight: 516.68
MDL number: MFCD00192446
| Pack Size | Price | Stock | Quantity |
| 5g | RMB925.41 | In Stock |
|
| 25g | RMB4059.04 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 64.7 °C |
| Density | 0.854 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 52 °F |
| storage temp. | 2-8°C |
| solubility | Water: Soluble |
| form | 20 wt.% in methanol |
| pka | 14.94±0.46(Predicted) |
| InChIKey | SENLDUJVTGGYIH-UHFFFAOYSA-N |
| SMILES | C(N(CCC(NCCN)=O)CCC(NCCN)=O)CN(CCC(NCCN)=O)CCC(NCCN)=O |
Description and Uses
PAMAM dendrimer belongs to the family of dendrimers, which can be used in biomedical and drug delivery applications.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P233-P280-P301+P310-P303+P361+P353-P304+P340+P311 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |







![<I>N</I>,<I>N</I>-<WBR>Bis[3-<WBR>(methylamino)<WBR>propyl]<WBR>methylamine](https://img.chemicalbook.com/CAS/GIF/123-70-6.gif)
