PRODUCT Properties
| Melting point: | 257 °C |
| Boiling point: | 563.6±50.0 °C(Predicted) |
| Density | 1.402±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO: 10 mM |
| form | A solid |
| pka | 6.34±0.40(Predicted) |
| color | Light yellow to light brown |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C17H14O6/c1-21-14-8-13-15(16(20)17(14)22-2)11(19)7-12(23-13)9-3-5-10(18)6-4-9/h3-8,18,20H,1-2H3 |
| InChIKey | ZIIAJIWLQUVGHB-UHFFFAOYSA-N |
| SMILES | COc1cc2OC(=CC(=O)c2c(O)c1OC)c3ccc(O)cc3 |
| LogP | 1.970 (est) |
Description and Uses
Cirsimaritin is a flavonoid obtained from Cirsium japonicum var. maackii pappus and is effective as an anti-inflammatory agent as well as antioxidant.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H410 |
| Precautionary statements | P273-P301+P310+P330 |
| Hazard Codes | T,N |
| Risk Statements | 25-50 |
| Safety Statements | 45-61 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |








