S808678
1,3-Didecyl-2-methylimidazolium chloride , 96% , 70862-65-6
CAS NO.：70862-65-6
Empirical Formula: C24H47ClN2
Molecular Weight: 399.1
MDL number: MFCD00216605
EINECS: 274-948-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB239.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82 °C |
| form | solid |
| color | Yellow to brown |
| InChI | 1S/C24H47N2.ClH/c1-4-6-8-10-12-14-16-18-20-25-22-23-26(24(25)3)21-19-17-15-13-11-9-7-5-2;/h22-23H,4-21H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GJYWPRKIEORZLX-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCCCCCCCCn1cc[n+](CCCCCCCCCC)c1C |
Description and Uses
1,3-Didecyl-2-methylimidazolium chloride can be used:
- To prepare a new ionic liquid named 1,3-didecyl-2-methylimidazolium dicyanamide, which is applicable in the water/butan-1-ol separation process.
- To coat a graphene oxide and magnetite based nanocomposite applicable in the separation of hemin from serum samples.
- As a pore directing agent in the synthesis of mesoporous hectorites for drug delivery applications.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
