S855178
(4R)-2-Hydroxy-5,5-dimethyl-4-phenyl-1,3,2-dioxaphosphorinan 2-oxide , 98% , 98674-80-7
Synonym(s):
(R)-(−)-2-Hydroxy-5,5-dimethyl-4-phenyl-1,3,2-dioxaphosphorinane 2-oxide;(2R,4R)-5,5-Dimethyl-2-hydroxy-4-phenyl-1,3,2-dioxaphosphorinan 2-oxide
| Pack Size | Price | Stock | Quantity |
| 1g | RMB831.48 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224-227 °C (lit.) |
| Boiling point: | 344.4±45.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 1.28±0.60(Predicted) |
| optical activity | [α]20/D 62°, c = 0.5 in methanol |
| BRN | 4294714 |
| InChI | 1S/C11H15O4P/c1-11(2)8-14-16(12,13)15-10(11)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,12,13)/t10-/m1/s1 |
| InChIKey | PSZSDCWNBXVDFG-SNVBAGLBSA-N |
| SMILES | CC1(C)COP(O)(=O)O[C@@H]1c2ccccc2 |
Description and Uses
(4R)-2-Hydroxy-5,5-dimethyl-4-phenyl-1,3,2-dioxaphosphorinan 2-oxide can be used:
- As a reactant in the phosphoalkoxylation of aromatic enones.
- As a chiral resolving agent in the resolution of amino acids, amines, and amino alcohols.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






