S899178
(S)-(?)-2-Hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide , 97% , 98674-83-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB263.34 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-196 °C(lit.) |
| storage temp. | 2-8°C |
| optical activity | [α]22/D 59°, c = 1 in methanol |
| InChI | 1S/C12H17O5P/c1-12(2)8-16-18(13,14)17-11(12)9-6-4-5-7-10(9)15-3/h4-7,11H,8H2,1-3H3,(H,13,14)/t11-/m1/s1 |
| InChIKey | HNFXKRNIAWHFJN-LLVKDONJSA-N |
| SMILES | COc1ccccc1[C@H]2OP(O)(=O)OCC2(C)C |
Description and Uses
Chiral phosphoric acid used for the resolution of amines, amino acids, and amino alcohols.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2835299000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
