S8648219
Fluazifop-butyl , PESTANAL ,analyticalstandard , 69806-50-4
CAS NO.:69806-50-4
Empirical Formula: C19H20F3NO4
Molecular Weight: 383.36
MDL number: MFCD00870330
EINECS: 274-125-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 13°C |
| Boiling point: | bp0.05 167° |
| Density | 1.2100 |
| Flash point: | 2 °C |
| storage temp. | 0-6°C |
| pka | 0.78±0.22(Predicted) |
| Water Solubility | 536.6ug/L(temperature not stated) |
| Merck | 13,4142 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C19H20F3NO4/c1-3-4-11-25-18(24)13(2)26-15-6-8-16(9-7-15)27-17-10-5-14(12-23-17)19(20,21)22/h5-10,12-13H,3-4,11H2,1-2H3 |
| InChIKey | VAIZTNZGPYBOGF-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C(C)Oc1ccc(Oc2ccc(cn2)C(F)(F)F)cc1 |
| EPA Substance Registry System | Fluazifop-butyl (69806-50-4) |
Description and Uses
Food additive; herbicide; agricultural chemical.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360-H410 |
| Precautionary statements | P201-P202-P273-P280-P308+P313-P391 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N,Xn,F |
| Risk Statements | 61-50/53-36-20/21/22-11 |
| Safety Statements | 53-45-60-61-36-26-16 |
| RIDADR | UN3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | UA3000000 |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
| Hazardous Substances Data | 69806-50-4(Hazardous Substances Data) |






