S891078
(R)-(+)-N-(1-Phenylethyl)succinamic acid , 98% , 21752-33-0
Synonym(s):
(R)-(+)-N-(α-Methylbenzyl)succinamidic acid
CAS NO.：21752-33-0
Empirical Formula: C12H15NO3
Molecular Weight: 221.25
MDL number: MFCD00077432
EINECS: 244-567-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB413.74 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-104 °C (lit.) |
| Boiling point: | 470.0±38.0 °C(Predicted) |
| Density | 1.167±0.06 g/cm3(Predicted) |
| storage temp. | Store below +30°C. |
| pka | 4.72±0.10(Predicted) |
| form | solid |
| Appearance | White to light yellow Solid |
| optical activity | [α]24/D +111°, c = 2 in ethanol |
| BRN | 3205512 |
| InChI | 1S/C12H15NO3/c1-9(10-5-3-2-4-6-10)13-11(14)7-8-12(15)16/h2-6,9H,7-8H2,1H3,(H,13,14)(H,15,16)/t9-/m1/s1 |
| InChIKey | WUEKFTPKHWMMIP-SECBINFHSA-N |
| SMILES | C[C@@H](NC(=O)CCC(O)=O)c1ccccc1 |
Description and Uses
Acid for the resolution of amines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 13 - Non Combustible Solids |
