S891878
Farnesal, mixture of isomers , technical , 19317-11-4
Synonym(s):
3,7,11-Trimethyl-2,6,10-dodecatrienal
CAS NO.：19317-11-4
Empirical Formula: C15H24O
Molecular Weight: 220.35
MDL number: MFCD00038089
EINECS: 242-957-9
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB2550.12 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 126-129 °C3.5 mm Hg(lit.) |
| Density | 0.909 g/mL at 25 °C(lit.) |
| FEMA | 4019 | 3,7,11-TRIMETHYL-2,6,10-DODECATRIENAL |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Amber Vial, Refrigerator |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | Oil |
| color | Pale Yellow to Yellow |
| Odor | floral minty |
| Odor Type | floral |
| biological source | synthetic |
| JECFA Number | 1228 |
| BRN | 1723427 |
| Stability: | Light Sensitive |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+ |
| InChIKey | YHRUHBBTQZKMEX-YFVJMOTDSA-N |
| SMILES | [H]C(=O)\C=C(/C)CC\C=C(/C)CC\C=C(/C)C |
| LogP | 5.20 |
| EPA Substance Registry System | 2,6,10-Dodecatrienal, 3,7,11-trimethyl- (19317-11-4) |
Description and Uses
Farnesone is s useful building block for organic synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| F | 1-10 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
