S8939614
Cibenzoline succinate , ≥98%(HPLC),solid , 100678-32-8
Synonym(s):
2-(2,2-diphenylcyclopropyl)-4,5-dihydro-1H-imidazole succinate;Cibenol;Cipralan;Exacor
CAS NO.：100678-32-8
Empirical Formula: C22H24N2O4
Molecular Weight: 380.44
MDL number: MFCD00941423
EINECS: 634-471-4
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1652.06 | In Stock |
|
| 50mg | RMB6596.16 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165° |
| storage temp. | 2-8°C |
| solubility | H2O: ≥5mg/mL |
| form | solid |
| color | white to off-white |
| Water Solubility | H2O: ≥5mg/mL |
| Stability: | Light Sensitive |
| InChI | 1S/C18H18N2.C4H6O4/c1-3-7-14(8-4-1)18(15-9-5-2-6-10-15)13-16(18)17-19-11-12-20-17;5-3(6)1-2-4(7)8/h1-10,16H,11-13H2,(H,19,20);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | XFUIOIWYMHEPIE-UHFFFAOYSA-N |
| SMILES | OC(=O)CCC(O)=O.C1CN=C(N1)C2CC2(c3ccccc3)c4ccccc4 |
Description and Uses
Cardiac depressant (anti-arrhythmic).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | EJ9960100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
