S9024114
≥95%(HPLC) , 96323-41-0
CAS NO.：96323-41-0
Empirical Formula: C23H37ClN8O5
Molecular Weight: 541.05
MDL number: MFCD00792772
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3043.77 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| form | powder |
| color | White to off-white |
| Water Solubility | water: 1mg/mL, clear, colorless to faintly yellow |
| InChIKey | YSYQQKNJMACZCI-ASLVLMPBNA-N |
| SMILES | C([C@@H]1CCCN1C(=O)[C@H](N)[C@H](C)CC)(=O)N[C@@H](CCCNC(N)=N)C(=O)NC1C=CC(N(=O)=O)=CC=1.Cl |&1:1,8,10,16,r| |
Description and Uses
D-Ile-Pro-Arg p-nitroanilide dihydrochloride is a chromogenic peptide substrate of tissue plasminogen activator (tPA)[1].
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H361-H373 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-33-36/37/38-63 |
| Safety Statements | 28-36/37-45 |
| WGK Germany | 3 |
