A0698512
L-Arginine p-nitroanilide dihydrochloride , 98% , 40127-11-5
CAS NO.:40127-11-5
Empirical Formula: C12H20Cl2N6O3
Molecular Weight: 367.23
MDL number: MFCD00058249
| Pack Size | Price | Stock | Quantity |
| 1G | RMB155.20 | In Stock |
|
| 5G | RMB812.00 | In Stock |
|
| 25G | RMB3664.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid |
| color | Off-white to light yellow |
| optical activity | Consistent with structure |
| InChI | 1S/C12H18N6O3.ClH/c13-10(2-1-7-16-12(14)15)11(19)17-8-3-5-9(6-4-8)18(20)21;/h3-6,10H,1-2,7,13H2,(H,17,19)(H4,14,15,16);1H/t10-;/m0./s1 |
| InChIKey | KBODDOUNTSALJF-PPHPATTJSA-N |
| SMILES | Cl.N[C@@H](CCCNC(N)=N)C(=O)Nc1ccc(cc1)N(=O)=O |
| CAS DataBase Reference | 40127-11-5(CAS DataBase Reference) |
Description and Uses
L-Arginine p-Nitroanilide Dihydrochloride can be used to prepare flavor peptide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2929900090 |
| Storage Class | 11 - Combustible Solids |






