S9059914
≥95% , 26112-88-9
Synonym(s):
PNP-a-NeuNAc
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1981.57 | In Stock |
|
| 5mg | RMB6968.57 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | methanol: 25mg/mL, clear, colorless to faintly yellow |
| form | powder |
| InChI | 1S/C17H22N2O11/c1-8(21)18-13-11(22)6-17(16(25)26,30-15(13)14(24)12(23)7-20)29-10-4-2-9(3-5-10)19(27)28/h2-5,11-15,20,22-24H,6-7H2,1H3,(H,18,21)(H,25,26) |
| InChIKey | OICUZSPXIJAAEA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(O)CC(OC1C(O)C(O)CO)(Oc2ccc(cc2)N(=O)=O)C(O)=O |
Description and Uses
2-O-(p-Nitrophenyl)-α-D-N-acetylneuraminic acid may be used as a substrate to measure sialidase enzyme activity.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335-H351 |
| Precautionary statements | P201-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38-40 |
| Safety Statements | 22-26-36/37/39-45 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
