S9072314
≥98% , 10139-02-3
Synonym(s):
p-Nitrophenyl 2-acetamido-2-deoxy-α-D -glucopyranoside
CAS NO.:10139-02-3
Empirical Formula: C14H18N2O8
Molecular Weight: 342.3
MDL number: MFCD00006592
EINECS: 233-392-9
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1485.94 | In Stock |
|
| 25mg | RMB3043.77 | In Stock |
|
| 100mg | RMB9214.47 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 264 °C |
| Boiling point: | 477.77°C (rough estimate) |
| Density | 1.3038 (rough estimate) |
| refractive index | 1.5110 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly, heated) |
| form | Solid |
| pka | 12.76±0.70(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | 1S/C14H18N2O8/c1-7(18)15-11-13(20)12(19)10(6-17)24-14(11)23-9-4-2-8(3-5-9)16(21)22/h2-5,10-14,17,19-20H,6H2,1H3,(H,15,18)/t10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | OMRLTNCLYHKQCK-KSTCHIGDSA-N |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1Oc2ccc(cc2)[N+]([O-])=O |
| CAS DataBase Reference | 10139-02-3(CAS DataBase Reference) |
Description and Uses
A useful substrate for assays of N-acetyl-alpha-galactosaminidase used in detection of Sanfilippo syndrome B.
Safety
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |





