S925279
4-(4-Diethylaminostyryl)-1-methylpyridinium iodide , ≥97% , 105802-46-8
Synonym(s):
4-Di-2-ASP
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB916.99 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214-216 °C(lit.) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | DMF: soluble |
| form | Solid |
| color | Red solid |
| λmax | 488 nm (MeOH); 484.7 nm
(DMSO); 471 nm (H2O) |
| BRN | 6101936 |
| Biological Applications | Assessing nerveultrastructure; characterizing Merkel cells andmechanosensory axons; diagnosing of Hirschsprung’sdisease; identifying neuroepithelial bodies (NEBs);investigating stability and release properties ofbiodegradable polylactic acid (PLA) particles;measuring blood cells (erythrocytes, reticulocytes, bloodplatelets);visualizing nerve terminals and myelinatedfibers |
| Major Application | Bentonite clay;characterizing supramolecular materials; visualizingmesopores and defects in porous molecular sieves;nonlinear optical devices/materials; photographicmaterials/systems;photoresists |
| InChI | 1S/C18H23N2.HI/c1-4-20(5-2)18-10-8-16(9-11-18)6-7-17-12-14-19(3)15-13-17;/h6-15H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WIPKWLIHFGTFQV-UHFFFAOYSA-M |
| SMILES | [I-].CCN(CC)c1ccc(\C=C\c2cc[n+](C)cc2)cc1 |
Description and Uses
Fluorescent cationic styryl probe for mitochondrial staining
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






