PRODUCT Properties
| Melting point: | 191-193 °C (lit.) |
| form | powder |
| InChI | 1S/C20H16N4/c1-13-11-17-18(12-14(13)2)24-20(16-8-4-6-10-22-16)19(23-17)15-7-3-5-9-21-15/h3-12H,1-2H3 |
| InChIKey | NACXMBPTPBZQHY-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc(-c3ccccn3)c(nc2cc1C)-c4ccccn4 |
| CAS DataBase Reference | 6627-38-9 |
Description and Uses
6,7-Dimethyl-2,3-di-(2-pyridyl)quinoxaline has been used as an internal standard to investigate the clinical pharmacokinetics of nelfinavir mesylate, a potent inhibitor of HIV-1 protease.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
