S9511548
1.0?mg/mLinacetonitrile,ampuleof1?mL,certifiedreferencematerial,Cerilliant? , 71267-22-6
Synonym(s):
NAT
CAS NO.:71267-22-6
Empirical Formula: C10H11N3O
Molecular Weight: 189.21
MDL number: MFCD01632691
EINECS: 690-329-1
| Pack Size | Price | Stock | Quantity |
| 1mL | RMB2116.48 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 324.47°C (rough estimate) |
| Density | 1.1654 (rough estimate) |
| refractive index | 1.4830 (estimate) |
| Flash point: | 2℃ |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 5.06±0.12(Predicted) |
| form | Oil |
| color | Pale Yellow to Brown |
| Stability: | Light Sensitive |
| Major Application | forensics and toxicology |
| InChI | 1S/C10H11N3O/c14-12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h1-4,6,8,10H,5,7H2/t10-/m0/s1 |
| InChIKey | ZJOFAFWTOKDIFH-JTQLQIEISA-N |
| SMILES | N1([C@@H](CC=CC1)c2cnccc2)N=O |
| CAS DataBase Reference | 71267-22-6(CAS DataBase Reference) |
| IARC | 3 (Vol. 37, Sup 7, 89) 2007 |
Description and Uses
The S-enantiomer metabolite of tobacco, a specific N-nitrosamines with carcinogenic activity.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H332-H319 |
| Precautionary statements | P210-P305+P351+P338 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |





